C16H27NO4SSi — CID 11977311
N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 11977311) has the molecular formula C16H27NO4SSi and a molecular weight of 357.55 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11977311 |
| Molecular Formula | C16H27NO4SSi |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C=O)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27NO4SSi/c1-13-7-9-15(10-8-13)22(19,20)17-14(11-18)12-21-23(5,6)16(2,3)4/h7-11,14,17H,12H2,1-6H3/t14-/m1/s1 |
| InChIKey | FKVYVBGNVIHOPE-CQSZACIVSA-N |
| XLogP | 2.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|