C15H26ClN3O2 — CID 119773833
4-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]-3-ethylpiperazin-2-one;hydrochloride (PubChem CID 119773833) has the molecular formula C15H26ClN3O2 and a molecular weight of 315.85 g/mol. Its IUPAC name is 4-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]-3-ethylpiperazin-2-one;hydrochloride.
| Compound Name | 4-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]-3-ethylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119773833 |
| Molecular Formula | C15H26ClN3O2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]-3-ethylpiperazin-2-one;hydrochloride |
| SMILES | CCC1C(=O)NCCN1C(=O)CC1CC2CCC(C1)N2.Cl |
| InChI | InChI=1S/C15H25N3O2.ClH/c1-2-13-15(20)16-5-6-18(13)14(19)9-10-7-11-3-4-12(8-10)17-11;/h10-13,17H,2-9H2,1H3,(H,16,20);1H |
| InChIKey | LIHKMJOJPHGNGC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |