C25H35N3O3 — CID 92633607
(3R)-3-ethyl-4-[2-[1-(1-phenylcyclopentanecarbonyl)piperidin-4-yl]acetyl]piperazin-2-one (PubChem CID 92633607) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is (3R)-3-ethyl-4-[2-[1-(1-phenylcyclopentanecarbonyl)piperidin-4-yl]acetyl]piperazin-2-one.
| Compound Name | (3R)-3-ethyl-4-[2-[1-(1-phenylcyclopentanecarbonyl)piperidin-4-yl]acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 92633607 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | (3R)-3-ethyl-4-[2-[1-(1-phenylcyclopentanecarbonyl)piperidin-4-yl]acetyl]piperazin-2-one |
| SMILES | CC[C@@H]1C(=O)NCCN1C(=O)CC1CCN(C(=O)C2(c3ccccc3)CCCC2)CC1 |
| InChI | InChI=1S/C25H35N3O3/c1-2-21-23(30)26-14-17-28(21)22(29)18-19-10-15-27(16-11-19)24(31)25(12-6-7-13-25)20-8-4-3-5-9-20/h3-5,8-9,19,21H,2,6-7,10-18H2,1H3,(H,26,30)/t21-/m1/s1 |
| InChIKey | TUKQPMXHKZDBFU-OAQYLSRUSA-N |
| XLogP | 2.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |