C18H24ClN5O — CID 119774767
N-(3-phenylcyclobutyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119774767) has the molecular formula C18H24ClN5O and a molecular weight of 361.88 g/mol. Its IUPAC name is N-(3-phenylcyclobutyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(3-phenylcyclobutyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119774767 |
| Molecular Formula | C18H24ClN5O |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(3-phenylcyclobutyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CC(c2ccccc2)C1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C18H23N5O.ClH/c24-18(17-12-23(22-21-17)16-6-8-19-9-7-16)20-15-10-14(11-15)13-4-2-1-3-5-13;/h1-5,12,14-16,19H,6-11H2,(H,20,24);1H |
| InChIKey | IZXZYSMQLAUFMI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |