C20H28N6O — CID 119855967
N-(1-benzylpiperidin-3-yl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119855967) has the molecular formula C20H28N6O and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119855967 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NC1CCCN(Cc2ccccc2)C1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C20H28N6O/c27-20(19-15-26(24-23-19)18-8-10-21-11-9-18)22-17-7-4-12-25(14-17)13-16-5-2-1-3-6-16/h1-3,5-6,15,17-18,21H,4,7-14H2,(H,22,27) |
| InChIKey | MVOYZCNWKJPPIE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |