C20H32N2O2S — CID 119776288
N-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-3-piperidin-4-ylbutanamide (PubChem CID 119776288) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is N-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119776288 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-3-piperidin-4-ylbutanamide |
| SMILES | COc1ccccc1SCC(C)CNC(=O)CC(C)C1CCNCC1 |
| InChI | InChI=1S/C20H32N2O2S/c1-15(14-25-19-7-5-4-6-18(19)24-3)13-22-20(23)12-16(2)17-8-10-21-11-9-17/h4-7,15-17,21H,8-14H2,1-3H3,(H,22,23) |
| InChIKey | HSCUGTGZRVWXHV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |