C18H25BrN2O2 — CID 119776314
N-[(5-bromo-2-ethoxyphenyl)methyl]-N-cyclopropyl-2-(cyclopropylmethylamino)acetamide (PubChem CID 119776314) has the molecular formula C18H25BrN2O2 and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[(5-bromo-2-ethoxyphenyl)methyl]-N-cyclopropyl-2-(cyclopropylmethylamino)acetamide.
| Compound Name | N-[(5-bromo-2-ethoxyphenyl)methyl]-N-cyclopropyl-2-(cyclopropylmethylamino)acetamide |
|---|---|
| PubChem CID | 119776314 |
| Molecular Formula | C18H25BrN2O2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-[(5-bromo-2-ethoxyphenyl)methyl]-N-cyclopropyl-2-(cyclopropylmethylamino)acetamide |
| SMILES | CCOc1ccc(Br)cc1CN(C(=O)CNCC1CC1)C1CC1 |
| InChI | InChI=1S/C18H25BrN2O2/c1-2-23-17-8-5-15(19)9-14(17)12-21(16-6-7-16)18(22)11-20-10-13-3-4-13/h5,8-9,13,16,20H,2-4,6-7,10-12H2,1H3 |
| InChIKey | DJBZSOBNZMIGPB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |