C12H23N3O3S2 — CID 119777081
2-pyrrolidin-2-yl-N-(2-thiomorpholin-4-ylsulfonylethyl)acetamide (PubChem CID 119777081) has the molecular formula C12H23N3O3S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-N-(2-thiomorpholin-4-ylsulfonylethyl)acetamide.
| Compound Name | 2-pyrrolidin-2-yl-N-(2-thiomorpholin-4-ylsulfonylethyl)acetamide |
|---|---|
| PubChem CID | 119777081 |
| Molecular Formula | C12H23N3O3S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-pyrrolidin-2-yl-N-(2-thiomorpholin-4-ylsulfonylethyl)acetamide |
| SMILES | O=C(CC1CCCN1)NCCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C12H23N3O3S2/c16-12(10-11-2-1-3-13-11)14-4-9-20(17,18)15-5-7-19-8-6-15/h11,13H,1-10H2,(H,14,16) |
| InChIKey | AZLLVLFLQFVWDN-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |