C8H17N3O3S — CID 61371209
2-pyrrolidin-2-yl-N-(2-sulfamoylethyl)acetamide (PubChem CID 61371209) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-N-(2-sulfamoylethyl)acetamide.
| Compound Name | 2-pyrrolidin-2-yl-N-(2-sulfamoylethyl)acetamide |
|---|---|
| PubChem CID | 61371209 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-pyrrolidin-2-yl-N-(2-sulfamoylethyl)acetamide |
| SMILES | NS(=O)(=O)CCNC(=O)CC1CCCN1 |
| InChI | InChI=1S/C8H17N3O3S/c9-15(13,14)5-4-11-8(12)6-7-2-1-3-10-7/h7,10H,1-6H2,(H,11,12)(H2,9,13,14) |
| InChIKey | YWBLHVKWVSDMSI-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |