C19H34N2O3 — CID 119779842
(4-methoxypiperidin-4-yl)-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]methanone (PubChem CID 119779842) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is (4-methoxypiperidin-4-yl)-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]methanone.
| Compound Name | (4-methoxypiperidin-4-yl)-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119779842 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (4-methoxypiperidin-4-yl)-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]methanone |
| SMILES | COC1(C(=O)N2CCC(OC3CCC(C)CC3)CC2)CCNCC1 |
| InChI | InChI=1S/C19H34N2O3/c1-15-3-5-16(6-4-15)24-17-7-13-21(14-8-17)18(22)19(23-2)9-11-20-12-10-19/h15-17,20H,3-14H2,1-2H3 |
| InChIKey | CLWSGDMNBGTEOQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |