C20H36N4O3 — CID 119876665
2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide (PubChem CID 119876665) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 119876665 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide |
| SMILES | COC1(C(=O)N2CCN(CC(=O)NC3CCC(C)CC3)CC2)CCNCC1 |
| InChI | InChI=1S/C20H36N4O3/c1-16-3-5-17(6-4-16)22-18(25)15-23-11-13-24(14-12-23)19(26)20(27-2)7-9-21-10-8-20/h16-17,21H,3-15H2,1-2H3,(H,22,25) |
| InChIKey | XZRXXRLGAXXMCX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |