C19H34N4O3 — CID 119851426
2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-1-(2-methylpiperidin-1-yl)ethanone (PubChem CID 119851426) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-1-(2-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-1-(2-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 119851426 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 2-[4-(4-methoxypiperidine-4-carbonyl)piperazin-1-yl]-1-(2-methylpiperidin-1-yl)ethanone |
| SMILES | COC1(C(=O)N2CCN(CC(=O)N3CCCCC3C)CC2)CCNCC1 |
| InChI | InChI=1S/C19H34N4O3/c1-16-5-3-4-10-23(16)17(24)15-21-11-13-22(14-12-21)18(25)19(26-2)6-8-20-9-7-19/h16,20H,3-15H2,1-2H3 |
| InChIKey | JAZAWMRREIIIQI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |