About N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride
N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride (PubChem CID 119780639) has the molecular formula C19H19ClFN3O2
and a molecular weight of 375.83 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
| PubChem CID | 119780639 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CCCN1)Nc1ccc2nc(-c3ccc(F)cc3)oc2c1 |
| InChI | InChI=1S/C19H18FN3O2.ClH/c20-13-5-3-12(4-6-13)19-23-16-8-7-15(10-17(16)25-19)22-18(24)11-14-2-1-9-21-14;/h3-8,10,14,21H,1-2,9,11H2,(H,22,24);1H |
| InChIKey | QXBQORHETISRFB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride?
The IUPAC name of N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride (CID 119780639) is N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride.
What is the SMILES notation for N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride?
The canonical SMILES for N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride is Cl.O=C(CC1CCCN1)Nc1ccc2nc(-c3ccc(F)cc3)oc2c1.
What is the InChIKey of N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride?
The InChIKey is QXBQORHETISRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN3O2.ClH/c20-13-5-3-12(4-6-13)19-23-16-8-7-15(10-17(16)25-19)22-18(24)11-14-2-1-9-21-14;/h3-8,10,14,21H,1-2,9,11H2,(H,22,24);1H.
What are the key properties of N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride?
N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride has a molecular weight of 375.83 g/mol, XLogP of 4.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-fluorophenyl)-1,3-benzoxazol-6-yl]-2-pyrrolidin-2-ylacetamide;hydrochloride is sourced from PubChem (CID 119780639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).