C19H28N2OS — CID 119782649
3-amino-N-[(1-phenylsulfanylcyclopentyl)methyl]cyclohexane-1-carboxamide (PubChem CID 119782649) has the molecular formula C19H28N2OS and a molecular weight of 332.51 g/mol. Its IUPAC name is 3-amino-N-[(1-phenylsulfanylcyclopentyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[(1-phenylsulfanylcyclopentyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119782649 |
| Molecular Formula | C19H28N2OS |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 3-amino-N-[(1-phenylsulfanylcyclopentyl)methyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)NCC2(Sc3ccccc3)CCCC2)C1 |
| InChI | InChI=1S/C19H28N2OS/c20-16-8-6-7-15(13-16)18(22)21-14-19(11-4-5-12-19)23-17-9-2-1-3-10-17/h1-3,9-10,15-16H,4-8,11-14,20H2,(H,21,22) |
| InChIKey | MXDHUABZUOIFNS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |