C20H28N2OS — CID 120989527
9-amino-N-[(1-phenylsulfanylcyclopropyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120989527) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is 9-amino-N-[(1-phenylsulfanylcyclopropyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-[(1-phenylsulfanylcyclopropyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120989527 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 9-amino-N-[(1-phenylsulfanylcyclopropyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | NC1C2CCCC1CC(C(=O)NCC1(Sc3ccccc3)CC1)C2 |
| InChI | InChI=1S/C20H28N2OS/c21-18-14-5-4-6-15(18)12-16(11-14)19(23)22-13-20(9-10-20)24-17-7-2-1-3-8-17/h1-3,7-8,14-16,18H,4-6,9-13,21H2,(H,22,23) |
| InChIKey | JOVRTSCOXOCGTK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |