C18H26ClN3O2 — CID 119783983
2-(cyclopropylmethylamino)-N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]acetamide;hydrochloride (PubChem CID 119783983) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]acetamide;hydrochloride.
| Compound Name | 2-(cyclopropylmethylamino)-N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119783983 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CNCC1CC1)NCCCC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H25N3O2.ClH/c22-17(11-19-10-14-7-8-14)20-9-3-6-18(23)21-12-15-4-1-2-5-16(15)13-21;/h1-2,4-5,14,19H,3,6-13H2,(H,20,22);1H |
| InChIKey | AUDUKFCLJHDAFY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|