C17H26N2O4 — CID 119784200
methyl 4-[4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]phenoxy]butanoate (PubChem CID 119784200) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 4-[4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]phenoxy]butanoate |
|---|---|
| PubChem CID | 119784200 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | methyl 4-[4-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(NC(=O)[C@@H](N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)15(18)16(21)19-12-7-9-13(10-8-12)23-11-5-6-14(20)22-4/h7-10,15H,5-6,11,18H2,1-4H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | OYRWYLSBBDOKSP-OAHLLOKOSA-N |
| XLogP | 2.33 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|