C20H25ClN2O4 — CID 119951488
methyl 4-[4-[(3-amino-3-phenylpropanoyl)amino]phenoxy]butanoate;hydrochloride (PubChem CID 119951488) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is methyl 4-[4-[(3-amino-3-phenylpropanoyl)amino]phenoxy]butanoate;hydrochloride.
| Compound Name | methyl 4-[4-[(3-amino-3-phenylpropanoyl)amino]phenoxy]butanoate;hydrochloride |
|---|---|
| PubChem CID | 119951488 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | methyl 4-[4-[(3-amino-3-phenylpropanoyl)amino]phenoxy]butanoate;hydrochloride |
| SMILES | COC(=O)CCCOc1ccc(NC(=O)CC(N)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H24N2O4.ClH/c1-25-20(24)8-5-13-26-17-11-9-16(10-12-17)22-19(23)14-18(21)15-6-3-2-4-7-15;/h2-4,6-7,9-12,18H,5,8,13-14,21H2,1H3,(H,22,23);1H |
| InChIKey | WABKFSKVBSUDFP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|