C19H24ClN3O3 — CID 119950653
3-amino-N-[2-(4-ethoxyanilino)-2-oxoethyl]-3-phenylpropanamide;hydrochloride (PubChem CID 119950653) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 3-amino-N-[2-(4-ethoxyanilino)-2-oxoethyl]-3-phenylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-[2-(4-ethoxyanilino)-2-oxoethyl]-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119950653 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-amino-N-[2-(4-ethoxyanilino)-2-oxoethyl]-3-phenylpropanamide;hydrochloride |
| SMILES | CCOc1ccc(NC(=O)CNC(=O)CC(N)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H23N3O3.ClH/c1-2-25-16-10-8-15(9-11-16)22-19(24)13-21-18(23)12-17(20)14-6-4-3-5-7-14;/h3-11,17H,2,12-13,20H2,1H3,(H,21,23)(H,22,24);1H |
| InChIKey | ZONOMPXBKFHVQG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |