C11H24N2O4S — CID 119785626
N-ethyl-2-(2-methoxyethylamino)-N-(1-methylsulfonylpropan-2-yl)acetamide (PubChem CID 119785626) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-ethyl-2-(2-methoxyethylamino)-N-(1-methylsulfonylpropan-2-yl)acetamide.
| Compound Name | N-ethyl-2-(2-methoxyethylamino)-N-(1-methylsulfonylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 119785626 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-ethyl-2-(2-methoxyethylamino)-N-(1-methylsulfonylpropan-2-yl)acetamide |
| SMILES | CCN(C(=O)CNCCOC)C(C)CS(C)(=O)=O |
| InChI | InChI=1S/C11H24N2O4S/c1-5-13(10(2)9-18(4,15)16)11(14)8-12-6-7-17-3/h10,12H,5-9H2,1-4H3 |
| InChIKey | LLHDAPHUTQABIG-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|