C11H25ClN2O4S — CID 119786618
2-(2-methoxyethylamino)-N-methyl-N-(3-methylsulfonylbutan-2-yl)acetamide;hydrochloride (PubChem CID 119786618) has the molecular formula C11H25ClN2O4S and a molecular weight of 316.85 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-methyl-N-(3-methylsulfonylbutan-2-yl)acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-methyl-N-(3-methylsulfonylbutan-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119786618 |
| Molecular Formula | C11H25ClN2O4S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-methyl-N-(3-methylsulfonylbutan-2-yl)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)N(C)C(C)C(C)S(C)(=O)=O.Cl |
| InChI | InChI=1S/C11H24N2O4S.ClH/c1-9(10(2)18(5,15)16)13(3)11(14)8-12-6-7-17-4;/h9-10,12H,6-8H2,1-5H3;1H |
| InChIKey | WOCAEYCSWNQBGZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|