C15H21ClN4O2S — CID 119787258
N-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119787258) has the molecular formula C15H21ClN4O2S and a molecular weight of 356.88 g/mol. Its IUPAC name is N-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119787258 |
| Molecular Formula | C15H21ClN4O2S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1nnc(-c2cc(C)cc(C)c2)s1.Cl |
| InChI | InChI=1S/C15H20N4O2S.ClH/c1-10-6-11(2)8-12(7-10)14-18-19-15(22-14)17-13(20)9-16-4-5-21-3;/h6-8,16H,4-5,9H2,1-3H3,(H,17,19,20);1H |
| InChIKey | JXXUJXNOSXGSTH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|