C18H23ClN2O2S — CID 119790386
3-amino-2-methyl-N-[3-(methylsulfinylmethyl)phenyl]-3-phenylpropanamide;hydrochloride (PubChem CID 119790386) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[3-(methylsulfinylmethyl)phenyl]-3-phenylpropanamide;hydrochloride.
| Compound Name | 3-amino-2-methyl-N-[3-(methylsulfinylmethyl)phenyl]-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119790386 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-amino-2-methyl-N-[3-(methylsulfinylmethyl)phenyl]-3-phenylpropanamide;hydrochloride |
| SMILES | CC(C(=O)Nc1cccc(CS(C)=O)c1)C(N)c1ccccc1.Cl |
| InChI | InChI=1S/C18H22N2O2S.ClH/c1-13(17(19)15-8-4-3-5-9-15)18(21)20-16-10-6-7-14(11-16)12-23(2)22;/h3-11,13,17H,12,19H2,1-2H3,(H,20,21);1H |
| InChIKey | JPPAQPLRJMXZHP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |