C15H23NO2S2 — CID 96550974
(2R)-2-butylsulfanyl-N-[3-[[(S)-methylsulfinyl]methyl]phenyl]propanamide (PubChem CID 96550974) has the molecular formula C15H23NO2S2 and a molecular weight of 313.49 g/mol. Its IUPAC name is (2R)-2-butylsulfanyl-N-[3-[[(S)-methylsulfinyl]methyl]phenyl]propanamide.
| Compound Name | (2R)-2-butylsulfanyl-N-[3-[[(S)-methylsulfinyl]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 96550974 |
| Molecular Formula | C15H23NO2S2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (2R)-2-butylsulfanyl-N-[3-[[(S)-methylsulfinyl]methyl]phenyl]propanamide |
| SMILES | CCCCS[C@H](C)C(=O)Nc1cccc(C[S@](C)=O)c1 |
| InChI | InChI=1S/C15H23NO2S2/c1-4-5-9-19-12(2)15(17)16-14-8-6-7-13(10-14)11-20(3)18/h6-8,10,12H,4-5,9,11H2,1-3H3,(H,16,17)/t12-,20+/m1/s1 |
| InChIKey | YDZMVFRMDBVBJH-ODXCJYRJSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|