C19H27N3O4S — CID 119791178
(3-aminocyclohexyl)-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]methanone (PubChem CID 119791178) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is (3-aminocyclohexyl)-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]methanone.
| Compound Name | (3-aminocyclohexyl)-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119791178 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3-aminocyclohexyl)-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1cccc(C(=O)N2CCN(C(=O)C3CCCC(N)C3)CC2)c1 |
| InChI | InChI=1S/C19H27N3O4S/c1-27(25,26)17-7-3-5-15(13-17)19(24)22-10-8-21(9-11-22)18(23)14-4-2-6-16(20)12-14/h3,5,7,13-14,16H,2,4,6,8-12,20H2,1H3 |
| InChIKey | RWLIYWMFZAOZTK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |