C23H29ClN2O2 — CID 119792508
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(1-phenylethoxy)phenyl]acetamide;hydrochloride (PubChem CID 119792508) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(1-phenylethoxy)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(1-phenylethoxy)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119792508 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(1-phenylethoxy)phenyl]acetamide;hydrochloride |
| SMILES | CC(Oc1ccccc1NC(=O)CC1CC2CCC(C1)N2)c1ccccc1.Cl |
| InChI | InChI=1S/C23H28N2O2.ClH/c1-16(18-7-3-2-4-8-18)27-22-10-6-5-9-21(22)25-23(26)15-17-13-19-11-12-20(14-17)24-19;/h2-10,16-17,19-20,24H,11-15H2,1H3,(H,25,26);1H |
| InChIKey | PUAFBXVAZKVWEN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |