C14H24N2O3 — CID 119793015
(3-amino-2-bicyclo[2.2.1]heptanyl)-[2-(methoxymethyl)morpholin-4-yl]methanone (PubChem CID 119793015) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3-amino-2-bicyclo[2.2.1]heptanyl)-[2-(methoxymethyl)morpholin-4-yl]methanone.
| Compound Name | (3-amino-2-bicyclo[2.2.1]heptanyl)-[2-(methoxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 119793015 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (3-amino-2-bicyclo[2.2.1]heptanyl)-[2-(methoxymethyl)morpholin-4-yl]methanone |
| SMILES | COCC1CN(C(=O)C2C3CCC(C3)C2N)CCO1 |
| InChI | InChI=1S/C14H24N2O3/c1-18-8-11-7-16(4-5-19-11)14(17)12-9-2-3-10(6-9)13(12)15/h9-13H,2-8,15H2,1H3 |
| InChIKey | KDXRSHBMZIEIKQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |