C17H35ClN2O2 — CID 119795866
7-amino-N-[(2-tert-butyloxan-3-yl)methyl]heptanamide;hydrochloride (PubChem CID 119795866) has the molecular formula C17H35ClN2O2 and a molecular weight of 334.93 g/mol. Its IUPAC name is 7-amino-N-[(2-tert-butyloxan-3-yl)methyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[(2-tert-butyloxan-3-yl)methyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119795866 |
| Molecular Formula | C17H35ClN2O2 |
| Molecular Weight | 334.93 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 7-amino-N-[(2-tert-butyloxan-3-yl)methyl]heptanamide;hydrochloride |
| SMILES | CC(C)(C)C1OCCCC1CNC(=O)CCCCCCN.Cl |
| InChI | InChI=1S/C17H34N2O2.ClH/c1-17(2,3)16-14(9-8-12-21-16)13-19-15(20)10-6-4-5-7-11-18;/h14,16H,4-13,18H2,1-3H3,(H,19,20);1H |
| InChIKey | QLHHRYHGALOUOT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.93 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|