C19H36N2O2 — CID 99809170
3-[[(2R,3S)-2-tert-butyloxan-3-yl]methyl]-1-cycloheptyl-1-methylurea (PubChem CID 99809170) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 3-[[(2R,3S)-2-tert-butyloxan-3-yl]methyl]-1-cycloheptyl-1-methylurea.
| Compound Name | 3-[[(2R,3S)-2-tert-butyloxan-3-yl]methyl]-1-cycloheptyl-1-methylurea |
|---|---|
| PubChem CID | 99809170 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 3-[[(2R,3S)-2-tert-butyloxan-3-yl]methyl]-1-cycloheptyl-1-methylurea |
| SMILES | CN(C(=O)NC[C@@H]1CCCO[C@H]1C(C)(C)C)C1CCCCCC1 |
| InChI | InChI=1S/C19H36N2O2/c1-19(2,3)17-15(10-9-13-23-17)14-20-18(22)21(4)16-11-7-5-6-8-12-16/h15-17H,5-14H2,1-4H3,(H,20,22)/t15-,17+/m0/s1 |
| InChIKey | GGLIQAFVDOZMCE-DOTOQJQBSA-N |
| XLogP | 4.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |