C21H41IN4O2 — CID 119160679
3-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylcyclohexane-1-carboxamide;hydroiodide (PubChem CID 119160679) has the molecular formula C21H41IN4O2 and a molecular weight of 508.49 g/mol. Its IUPAC name is 3-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylcyclohexane-1-carboxamide;hydroiodide.
| Compound Name | 3-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylcyclohexane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 119160679 |
| Molecular Formula | C21H41IN4O2 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 3-[[N-[(2-tert-butyloxan-3-yl)methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylcyclohexane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCC1CCCOC1C(C)(C)C)NC1CCCC(C(=O)N(C)C)C1.I |
| InChI | InChI=1S/C21H40N4O2.HI/c1-21(2,3)18-16(10-8-12-27-18)14-23-20(22-4)24-17-11-7-9-15(13-17)19(26)25(5)6;/h15-18H,7-14H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | HVUXZUWFIAJQQD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|