C16H31N3O3S — CID 111792370
1-[(2-tert-butyloxan-3-yl)methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine (PubChem CID 111792370) has the molecular formula C16H31N3O3S and a molecular weight of 345.51 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111792370 |
| Molecular Formula | C16H31N3O3S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCCOC1C(C)(C)C)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H31N3O3S/c1-16(2,3)14-12(6-5-8-22-14)10-18-15(17-4)19-13-7-9-23(20,21)11-13/h12-14H,5-11H2,1-4H3,(H2,17,18,19) |
| InChIKey | LLXQIQZXRCNWCF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|