C17H27N5O3 — CID 119162412
5-[[[N-[3-(dimethylcarbamoyl)cyclohexyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide (PubChem CID 119162412) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 5-[[[N-[3-(dimethylcarbamoyl)cyclohexyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[[[N-[3-(dimethylcarbamoyl)cyclohexyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119162412 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 5-[[[N-[3-(dimethylcarbamoyl)cyclohexyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)o1)NC1CCCC(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C17H27N5O3/c1-19-17(20-10-13-7-8-14(25-13)15(18)23)21-12-6-4-5-11(9-12)16(24)22(2)3/h7-8,11-12H,4-6,9-10H2,1-3H3,(H2,18,23)(H2,19,20,21) |
| InChIKey | YLMIJOWKPZZBJB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|