C14H29N5O3S — CID 119154112
3-[[N-[2-(methanesulfonamido)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylcyclohexane-1-carboxamide (PubChem CID 119154112) has the molecular formula C14H29N5O3S and a molecular weight of 347.49 g/mol. Its IUPAC name is 3-[[N-[2-(methanesulfonamido)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylcyclohexane-1-carboxamide.
| Compound Name | 3-[[N-[2-(methanesulfonamido)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119154112 |
| Molecular Formula | C14H29N5O3S |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 3-[[N-[2-(methanesulfonamido)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylcyclohexane-1-carboxamide |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)NC1CCCC(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C14H29N5O3S/c1-15-14(16-8-9-17-23(4,21)22)18-12-7-5-6-11(10-12)13(20)19(2)3/h11-12,17H,5-10H2,1-4H3,(H2,15,16,18) |
| InChIKey | CCJAUKXHUTZODG-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|