C15H18ClIN4O2 — CID 111908138
5-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide (PubChem CID 111908138) has the molecular formula C15H18ClIN4O2 and a molecular weight of 448.69 g/mol. Its IUPAC name is 5-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 5-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111908138 |
| Molecular Formula | C15H18ClIN4O2 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 5-[[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(Cl)cc1)NCc1ccc(C(N)=O)o1.I |
| InChI | InChI=1S/C15H17ClN4O2.HI/c1-18-15(19-8-10-2-4-11(16)5-3-10)20-9-12-6-7-13(22-12)14(17)21;/h2-7H,8-9H2,1H3,(H2,17,21)(H2,18,19,20);1H |
| InChIKey | MLSYYGUBWGCOFG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|