C20H33N5O2 — CID 111908421
5-[[[N'-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide (PubChem CID 111908421) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 5-[[[N'-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide.
| Compound Name | 5-[[[N'-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111908421 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 5-[[[N'-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]carbamimidoyl]amino]methyl]furan-2-carboxamide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)o1)NCC1(N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C20H33N5O2/c1-22-19(23-14-16-8-9-17(27-16)18(21)26)24-15-20(10-4-2-5-11-20)25-12-6-3-7-13-25/h8-9H,2-7,10-15H2,1H3,(H2,21,26)(H2,22,23,24) |
| InChIKey | UDAUHOOIHOMLGL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|