C10H15F3N4O2 — CID 119796081
2-(2-methoxyethylamino)-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetamide (PubChem CID 119796081) has the molecular formula C10H15F3N4O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 119796081 |
| Molecular Formula | C10H15F3N4O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetamide |
| SMILES | COCCNCC(=O)Nc1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C10H15F3N4O2/c1-19-3-2-14-5-9(18)16-8-4-15-17(6-8)7-10(11,12)13/h4,6,14H,2-3,5,7H2,1H3,(H,16,18) |
| InChIKey | JGQUIIWGYMIQRT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|