C13H21N5O3 — CID 79270069
N-[1-[2-(cyclopropylamino)-2-oxoethyl]pyrazol-4-yl]-2-(2-methoxyethylamino)acetamide (PubChem CID 79270069) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[1-[2-(cyclopropylamino)-2-oxoethyl]pyrazol-4-yl]-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[1-[2-(cyclopropylamino)-2-oxoethyl]pyrazol-4-yl]-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 79270069 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[1-[2-(cyclopropylamino)-2-oxoethyl]pyrazol-4-yl]-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)Nc1cnn(CC(=O)NC2CC2)c1 |
| InChI | InChI=1S/C13H21N5O3/c1-21-5-4-14-7-12(19)17-11-6-15-18(8-11)9-13(20)16-10-2-3-10/h6,8,10,14H,2-5,7,9H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | OGBLKBLNXSQQFQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|