C21H28N4O3 — CID 49055601
4-butoxy-N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]benzamide (PubChem CID 49055601) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-butoxy-N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]benzamide.
| Compound Name | 4-butoxy-N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 49055601 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 4-butoxy-N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cnn(CC(=O)NC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C21H28N4O3/c1-2-3-12-28-19-10-8-16(9-11-19)21(27)24-18-13-22-25(14-18)15-20(26)23-17-6-4-5-7-17/h8-11,13-14,17H,2-7,12,15H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | NWFOKGOJRFVVFN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|