C16H26N4O2 — CID 49054716
N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-2-ethylbutanamide (PubChem CID 49054716) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-2-ethylbutanamide.
| Compound Name | N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 49054716 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[1-[2-(cyclopentylamino)-2-oxoethyl]pyrazol-4-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1cnn(CC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C16H26N4O2/c1-3-12(4-2)16(22)19-14-9-17-20(10-14)11-15(21)18-13-7-5-6-8-13/h9-10,12-13H,3-8,11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | LVVXBXKYWACHBS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |