C18H19ClF2N2O4 — CID 119801304
2-(4-aminophenyl)-N-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-N-methylacetamide;hydrochloride (PubChem CID 119801304) has the molecular formula C18H19ClF2N2O4 and a molecular weight of 400.81 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-N-methylacetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119801304 |
| Molecular Formula | C18H19ClF2N2O4 |
| Molecular Weight | 400.81 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-(4-aminophenyl)-N-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-N-methylacetamide;hydrochloride |
| SMILES | CN(Cc1cc2c(cc1OC(F)F)OCO2)C(=O)Cc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C18H18F2N2O4.ClH/c1-22(17(23)6-11-2-4-13(21)5-3-11)9-12-7-15-16(25-10-24-15)8-14(12)26-18(19)20;/h2-5,7-8,18H,6,9-10,21H2,1H3;1H |
| InChIKey | JVHSDOZCIDIUAL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|