C17H21F3N2O2 — CID 119805133
4-hydroxy-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 119805133) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-hydroxy-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119805133 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-hydroxy-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1(c2cccc(C(F)(F)F)c2)CCC1)C1CC(O)CN1 |
| InChI | InChI=1S/C17H21F3N2O2/c18-17(19,20)12-4-1-3-11(7-12)16(5-2-6-16)10-22-15(24)14-8-13(23)9-21-14/h1,3-4,7,13-14,21,23H,2,5-6,8-10H2,(H,22,24) |
| InChIKey | GAOXZCVYOOYYRP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |