C24H31ClN2O — CID 119810421
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[bis(3-methylphenyl)methyl]acetamide;hydrochloride (PubChem CID 119810421) has the molecular formula C24H31ClN2O and a molecular weight of 398.98 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[bis(3-methylphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[bis(3-methylphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119810421 |
| Molecular Formula | C24H31ClN2O |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[bis(3-methylphenyl)methyl]acetamide;hydrochloride |
| SMILES | Cc1cccc(C(NC(=O)CC2CC3CCC(C2)N3)c2cccc(C)c2)c1.Cl |
| InChI | InChI=1S/C24H30N2O.ClH/c1-16-5-3-7-19(11-16)24(20-8-4-6-17(2)12-20)26-23(27)15-18-13-21-9-10-22(14-18)25-21;/h3-8,11-12,18,21-22,24-25H,9-10,13-15H2,1-2H3,(H,26,27);1H |
| InChIKey | FWRNSVFAUSBFRF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |