C18H24ClN3O2 — CID 119819997
(3R)-3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-(3-chlorophenyl)propanamide (PubChem CID 119819997) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is (3R)-3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-(3-chlorophenyl)propanamide.
| Compound Name | (3R)-3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-(3-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 119819997 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (3R)-3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-(3-chlorophenyl)propanamide |
| SMILES | NC(=O)C[C@@H](NC(=O)CC1CC2CCC(C1)N2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H24ClN3O2/c19-13-3-1-2-12(9-13)16(10-17(20)23)22-18(24)8-11-6-14-4-5-15(7-11)21-14/h1-3,9,11,14-16,21H,4-8,10H2,(H2,20,23)(H,22,24)/t11?,14?,15?,16-/m1/s1 |
| InChIKey | LXTWYXJLOQCKNF-OJXGMBSESA-N |
| XLogP | 2.29 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |