C19H23ClN4O2 — CID 171539997
N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-cyclohexyl-1H-pyrazole-4-carboxamide (PubChem CID 171539997) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-cyclohexyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-cyclohexyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171539997 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-cyclohexyl-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)C[C@H](NC(=O)c1cn[nH]c1C1CCCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23ClN4O2/c20-14-8-4-7-13(9-14)16(10-17(21)25)23-19(26)15-11-22-24-18(15)12-5-2-1-3-6-12/h4,7-9,11-12,16H,1-3,5-6,10H2,(H2,21,25)(H,22,24)(H,23,26)/t16-/m0/s1 |
| InChIKey | WFMPCSKIOYYIJQ-INIZCTEOSA-N |
| XLogP | 3.46 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |