C19H25ClN4O2 — CID 171539960
(E)-3-amino-N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-3-cyclohexyl-2-methanimidoylprop-2-enamide (PubChem CID 171539960) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is (E)-3-amino-N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-3-cyclohexyl-2-methanimidoylprop-2-enamide.
| Compound Name | (E)-3-amino-N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-3-cyclohexyl-2-methanimidoylprop-2-enamide |
|---|---|
| PubChem CID | 171539960 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (E)-3-amino-N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-3-cyclohexyl-2-methanimidoylprop-2-enamide |
| SMILES | [H]/N=C/C(C(=O)N[C@@H](CC(N)=O)c1cccc(Cl)c1)=C(\N)C1CCCCC1 |
| InChI | InChI=1S/C19H25ClN4O2/c20-14-8-4-7-13(9-14)16(10-17(22)25)24-19(26)15(11-21)18(23)12-5-2-1-3-6-12/h4,7-9,11-12,16,21H,1-3,5-6,10,23H2,(H2,22,25)(H,24,26)/b18-15+,21-11+/t16-/m0/s1 |
| InChIKey | UQKBONAUOJOCLO-PECWHMSZSA-N |
| XLogP | 2.82 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|