C18H21ClN4O3 — CID 171539850
N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-(oxan-2-yl)-1H-pyrazole-4-carboxamide (PubChem CID 171539850) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-(oxan-2-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-(oxan-2-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171539850 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-(oxan-2-yl)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)C[C@H](NC(=O)c1cn[nH]c1C1CCCCO1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H21ClN4O3/c19-12-5-3-4-11(8-12)14(9-16(20)24)22-18(25)13-10-21-23-17(13)15-6-1-2-7-26-15/h3-5,8,10,14-15H,1-2,6-7,9H2,(H2,20,24)(H,21,23)(H,22,25)/t14-,15?/m0/s1 |
| InChIKey | ROZKEMXDHPOZAA-MLCCFXAWSA-N |
| XLogP | 2.65 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |