C19H19ClN6O3 — CID 171539384
N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-(2-prop-2-enoyl-3,4-dihydropyrazol-5-yl)-1H-pyrazole-4-carboxamide (PubChem CID 171539384) has the molecular formula C19H19ClN6O3 and a molecular weight of 414.85 g/mol. Its IUPAC name is N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-(2-prop-2-enoyl-3,4-dihydropyrazol-5-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-(2-prop-2-enoyl-3,4-dihydropyrazol-5-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171539384 |
| Molecular Formula | C19H19ClN6O3 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[(1S)-3-amino-1-(3-chlorophenyl)-3-oxopropyl]-5-(2-prop-2-enoyl-3,4-dihydropyrazol-5-yl)-1H-pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(c2[nH]ncc2C(=O)N[C@@H](CC(N)=O)c2cccc(Cl)c2)=N1 |
| InChI | InChI=1S/C19H19ClN6O3/c1-2-17(28)26-7-6-14(25-26)18-13(10-22-24-18)19(29)23-15(9-16(21)27)11-4-3-5-12(20)8-11/h2-5,8,10,15H,1,6-7,9H2,(H2,21,27)(H,22,24)(H,23,29)/t15-/m0/s1 |
| InChIKey | LJPBGWOEIJTUOM-HNNXBMFYSA-N |
| XLogP | 1.53 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|