C20H20ClFN4O2 — CID 170952101
3-(3-chlorophenyl)-3-formamidopropanamide;5-(2-fluorophenyl)-4-methyl-1H-pyrazole (PubChem CID 170952101) has the molecular formula C20H20ClFN4O2 and a molecular weight of 402.86 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-3-formamidopropanamide;5-(2-fluorophenyl)-4-methyl-1H-pyrazole.
| Compound Name | 3-(3-chlorophenyl)-3-formamidopropanamide;5-(2-fluorophenyl)-4-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 170952101 |
| Molecular Formula | C20H20ClFN4O2 |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-(3-chlorophenyl)-3-formamidopropanamide;5-(2-fluorophenyl)-4-methyl-1H-pyrazole |
| SMILES | Cc1cn[nH]c1-c1ccccc1F.NC(=O)CC(NC=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H11ClN2O2.C10H9FN2/c11-8-3-1-2-7(4-8)9(13-6-14)5-10(12)15;1-7-6-12-13-10(7)8-4-2-3-5-9(8)11/h1-4,6,9H,5H2,(H2,12,15)(H,13,14);2-6H,1H3,(H,12,13) |
| InChIKey | DHWYQPRTVADMHN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|