C19H20ClFN4O — CID 171540298
chlorobenzene;3-[[5-(2-fluorophenyl)-1H-pyrazol-4-yl]methylamino]propanamide (PubChem CID 171540298) has the molecular formula C19H20ClFN4O and a molecular weight of 374.85 g/mol. Its IUPAC name is chlorobenzene;3-[[5-(2-fluorophenyl)-1H-pyrazol-4-yl]methylamino]propanamide.
| Compound Name | chlorobenzene;3-[[5-(2-fluorophenyl)-1H-pyrazol-4-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 171540298 |
| Molecular Formula | C19H20ClFN4O |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | chlorobenzene;3-[[5-(2-fluorophenyl)-1H-pyrazol-4-yl]methylamino]propanamide |
| SMILES | Clc1ccccc1.NC(=O)CCNCc1cn[nH]c1-c1ccccc1F |
| InChI | InChI=1S/C13H15FN4O.C6H5Cl/c14-11-4-2-1-3-10(11)13-9(8-17-18-13)7-16-6-5-12(15)19;7-6-4-2-1-3-5-6/h1-4,8,16H,5-7H2,(H2,15,19)(H,17,18);1-5H |
| InChIKey | SAUGRCKEGPQTLU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|