C15H15ClN4O3 — CID 122148510
(3R)-3-(3-chlorophenyl)-3-[(5-methyl-3-nitro-2-pyridinyl)amino]propanamide (PubChem CID 122148510) has the molecular formula C15H15ClN4O3 and a molecular weight of 334.76 g/mol. Its IUPAC name is (3R)-3-(3-chlorophenyl)-3-[(5-methyl-3-nitro-2-pyridinyl)amino]propanamide.
| Compound Name | (3R)-3-(3-chlorophenyl)-3-[(5-methyl-3-nitro-2-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 122148510 |
| Molecular Formula | C15H15ClN4O3 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (3R)-3-(3-chlorophenyl)-3-[(5-methyl-3-nitro-2-pyridinyl)amino]propanamide |
| SMILES | Cc1cnc(N[C@H](CC(N)=O)c2cccc(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15ClN4O3/c1-9-5-13(20(22)23)15(18-8-9)19-12(7-14(17)21)10-3-2-4-11(16)6-10/h2-6,8,12H,7H2,1H3,(H2,17,21)(H,18,19)/t12-/m1/s1 |
| InChIKey | LBBNPSRLSYBHAQ-GFCCVEGCSA-N |
| XLogP | 2.98 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|